C20H28F2N2O2 — CID 11222339
2-amino-5-[[(2E)-2-benzylideneheptylidene]amino]-2-(difluoromethyl)pentanoic acid (PubChem CID 11222339) has the molecular formula C20H28F2N2O2 and a molecular weight of 366.45 g/mol. Its IUPAC name is 2-amino-5-[[(2E)-2-benzylideneheptylidene]amino]-2-(difluoromethyl)pentanoic acid.
| Compound Name | 2-amino-5-[[(2E)-2-benzylideneheptylidene]amino]-2-(difluoromethyl)pentanoic acid |
|---|---|
| PubChem CID | 11222339 |
| Molecular Formula | C20H28F2N2O2 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 2-amino-5-[[(2E)-2-benzylideneheptylidene]amino]-2-(difluoromethyl)pentanoic acid |
| SMILES | CCCCCC(/C=N/CCCC(N)(C(=O)O)C(F)F)=C\c1ccccc1 |
| InChI | InChI=1S/C20H28F2N2O2/c1-2-3-5-11-17(14-16-9-6-4-7-10-16)15-24-13-8-12-20(23,18(21)22)19(25)26/h4,6-7,9-10,14-15,18H,2-3,5,8,11-13,23H2,1H3,(H,25,26)/b17-14+,24-15+ |
| InChIKey | ULAMDFUYQQFTGV-RWOQWNJLSA-N |
| XLogP | 4.55 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|