C14H18F2N2O3 — CID 11460777
2-amino-2-(difluoromethyl)-5-[(4-methoxyphenyl)methylideneamino]pentanoic acid (PubChem CID 11460777) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-amino-2-(difluoromethyl)-5-[(4-methoxyphenyl)methylideneamino]pentanoic acid.
| Compound Name | 2-amino-2-(difluoromethyl)-5-[(4-methoxyphenyl)methylideneamino]pentanoic acid |
|---|---|
| PubChem CID | 11460777 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-amino-2-(difluoromethyl)-5-[(4-methoxyphenyl)methylideneamino]pentanoic acid |
| SMILES | COc1ccc(/C=N/CCCC(N)(C(=O)O)C(F)F)cc1 |
| InChI | InChI=1S/C14H18F2N2O3/c1-21-11-5-3-10(4-6-11)9-18-8-2-7-14(17,12(15)16)13(19)20/h3-6,9,12H,2,7-8,17H2,1H3,(H,19,20)/b18-9+ |
| InChIKey | AWBYWCSHDSMJDG-GIJQJNRQSA-N |
| XLogP | 1.94 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|