C24H37N — CID 123287010
4-hepta-2,4-dien-4-yl-2-hept-1-en-2-yl-6-pent-4-enyl-3,4-dihydropyridine (PubChem CID 123287010) has the molecular formula C24H37N and a molecular weight of 339.57 g/mol. Its IUPAC name is 4-hepta-2,4-dien-4-yl-2-hept-1-en-2-yl-6-pent-4-enyl-3,4-dihydropyridine.
| Compound Name | 4-hepta-2,4-dien-4-yl-2-hept-1-en-2-yl-6-pent-4-enyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 123287010 |
| Molecular Formula | C24H37N |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 339.29 |
| IUPAC Name | 4-hepta-2,4-dien-4-yl-2-hept-1-en-2-yl-6-pent-4-enyl-3,4-dihydropyridine |
| SMILES | C=CCCCC1=CC(C(C=CC)=CCC)CC(C(=C)CCCCC)=N1 |
| InChI | InChI=1S/C24H37N/c1-6-10-12-16-20(5)24-19-22(21(14-8-3)15-9-4)18-23(25-24)17-13-11-7-2/h7-8,14-15,18,22H,2,5-6,9-13,16-17,19H2,1,3-4H3 |
| InChIKey | IKXVMSAUXHFRRO-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|