About 2-decan-2-ylporphyrin
2-decan-2-ylporphyrin (PubChem CID 68760089) has the molecular formula C30H32N4
and a molecular weight of 448.61 g/mol. Its IUPAC name is 2-decan-2-ylporphyrin.
Molecular Properties
| Compound Name | 2-decan-2-ylporphyrin |
| PubChem CID | 68760089 |
| Molecular Formula | C30H32N4 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 2-decan-2-ylporphyrin |
| SMILES | CCCCCCCCC(C)C1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1 |
| InChI | InChI=1S/C30H32N4/c1-3-4-5-6-7-8-9-21(2)29-19-28-18-26-13-12-24(32-26)16-22-10-11-23(31-22)17-25-14-15-27(33-25)20-30(29)34-28/h10-21H,3-9H2,1-2H3/b22-16-,23-17-,24-16-,25-17-,26-18-,27-20-,28-18-,30-20- |
| InChIKey | GRRQVCLUEYPTPO-RKFGATASSA-N |
| XLogP | 7.34 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-decan-2-ylporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-decan-2-ylporphyrin?
The IUPAC name of 2-decan-2-ylporphyrin (CID 68760089) is 2-decan-2-ylporphyrin.
What is the SMILES notation for 2-decan-2-ylporphyrin?
The canonical SMILES for 2-decan-2-ylporphyrin is CCCCCCCCC(C)C1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1.
What is the InChIKey of 2-decan-2-ylporphyrin?
The InChIKey is GRRQVCLUEYPTPO-RKFGATASSA-N. The full InChI is InChI=1S/C30H32N4/c1-3-4-5-6-7-8-9-21(2)29-19-28-18-26-13-12-24(32-26)16-22-10-11-23(31-22)17-25-14-15-27(33-25)20-30(29)34-28/h10-21H,3-9H2,1-2H3/b22-16-,23-17-,24-16-,25-17-,26-18-,27-20-,28-18-,30-20-.
What are the key properties of 2-decan-2-ylporphyrin?
2-decan-2-ylporphyrin has a molecular weight of 448.61 g/mol, XLogP of 7.34, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-decan-2-ylporphyrin is sourced from PubChem (CID 68760089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).