C11H18F3N — CID 143346611
(E)-1,1,1-trifluoro-6-methyl-4-propylhept-3-en-2-imine (PubChem CID 143346611) has the molecular formula C11H18F3N and a molecular weight of 221.27 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-6-methyl-4-propylhept-3-en-2-imine.
| Compound Name | (E)-1,1,1-trifluoro-6-methyl-4-propylhept-3-en-2-imine |
|---|---|
| PubChem CID | 143346611 |
| Molecular Formula | C11H18F3N |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (E)-1,1,1-trifluoro-6-methyl-4-propylhept-3-en-2-imine |
| SMILES | [H]/N=C(\C=C(/CCC)CC(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H18F3N/c1-4-5-9(6-8(2)3)7-10(15)11(12,13)14/h7-8,15H,4-6H2,1-3H3/b9-7+,15-10+ |
| InChIKey | QCZQNVKQNZSYTR-VYPLWORKSA-N |
| XLogP | 4.34 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|