C17H31F2N — CID 178159868
3-butan-2-ylidene-4-ethyl-5,5-difluoro-8-methyldecan-2-imine (PubChem CID 178159868) has the molecular formula C17H31F2N and a molecular weight of 287.44 g/mol. Its IUPAC name is 3-butan-2-ylidene-4-ethyl-5,5-difluoro-8-methyldecan-2-imine.
| Compound Name | 3-butan-2-ylidene-4-ethyl-5,5-difluoro-8-methyldecan-2-imine |
|---|---|
| PubChem CID | 178159868 |
| Molecular Formula | C17H31F2N |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 3-butan-2-ylidene-4-ethyl-5,5-difluoro-8-methyldecan-2-imine |
| SMILES | [H]/N=C(\C)C(=C(C)CC)C(CC)C(F)(F)CCC(C)CC |
| InChI | InChI=1S/C17H31F2N/c1-7-12(4)10-11-17(18,19)15(9-3)16(14(6)20)13(5)8-2/h12,15,20H,7-11H2,1-6H3/b16-13?,20-14+ |
| InChIKey | UIDVUVHRQUHISF-PZKWXNAPSA-N |
| XLogP | 6.24 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|