C15H27F2N — CID 178168484
2-(3,3-difluorocyclobutyl)-4,5-dimethylhept-4-en-3-imine;ethane (PubChem CID 178168484) has the molecular formula C15H27F2N and a molecular weight of 259.38 g/mol. Its IUPAC name is 2-(3,3-difluorocyclobutyl)-4,5-dimethylhept-4-en-3-imine;ethane.
| Compound Name | 2-(3,3-difluorocyclobutyl)-4,5-dimethylhept-4-en-3-imine;ethane |
|---|---|
| PubChem CID | 178168484 |
| Molecular Formula | C15H27F2N |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | 2-(3,3-difluorocyclobutyl)-4,5-dimethylhept-4-en-3-imine;ethane |
| SMILES | CC.[H]/N=C(\C(C)=C(C)CC)C(C)C1CC(F)(F)C1 |
| InChI | InChI=1S/C13H21F2N.C2H6/c1-5-8(2)9(3)12(16)10(4)11-6-13(14,15)7-11;1-2/h10-11,16H,5-7H2,1-4H3;1-2H3/b9-8?,16-12+; |
| InChIKey | PPAPALJXRNMSEE-LHIHPOAVSA-N |
| XLogP | 5.46 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|