C13H21F2N — CID 178168485
2-(3,3-difluorocyclobutyl)-4,5-dimethylhept-4-en-3-imine (PubChem CID 178168485) has the molecular formula C13H21F2N and a molecular weight of 229.31 g/mol. Its IUPAC name is 2-(3,3-difluorocyclobutyl)-4,5-dimethylhept-4-en-3-imine.
| Compound Name | 2-(3,3-difluorocyclobutyl)-4,5-dimethylhept-4-en-3-imine |
|---|---|
| PubChem CID | 178168485 |
| Molecular Formula | C13H21F2N |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 2-(3,3-difluorocyclobutyl)-4,5-dimethylhept-4-en-3-imine |
| SMILES | [H]/N=C(\C(C)=C(C)CC)C(C)C1CC(F)(F)C1 |
| InChI | InChI=1S/C13H21F2N/c1-5-8(2)9(3)12(16)10(4)11-6-13(14,15)7-11/h10-11,16H,5-7H2,1-4H3/b9-8?,16-12+ |
| InChIKey | XOZNCNXAEZGUOZ-KEJXGJGSSA-N |
| XLogP | 4.43 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|