C11H16F3N — CID 143285811
(E)-1,1,1-trifluoro-4-prop-2-enyloct-3-en-2-imine (PubChem CID 143285811) has the molecular formula C11H16F3N and a molecular weight of 219.25 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-4-prop-2-enyloct-3-en-2-imine.
| Compound Name | (E)-1,1,1-trifluoro-4-prop-2-enyloct-3-en-2-imine |
|---|---|
| PubChem CID | 143285811 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | (E)-1,1,1-trifluoro-4-prop-2-enyloct-3-en-2-imine |
| SMILES | [H]/N=C(\C=C(\CC=C)CCCC)C(F)(F)F |
| InChI | InChI=1S/C11H16F3N/c1-3-5-7-9(6-4-2)8-10(15)11(12,13)14/h4,8,15H,2-3,5-7H2,1H3/b9-8-,15-10+ |
| InChIKey | IZARMQPJSMOVEK-ABRUBGJPSA-N |
| XLogP | 4.26 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|