C11H19F2N — CID 171833118
(4E)-4-ethylidene-5,5-difluoro-N,2-dimethylheptan-3-imine (PubChem CID 171833118) has the molecular formula C11H19F2N and a molecular weight of 203.28 g/mol. Its IUPAC name is (4E)-4-ethylidene-5,5-difluoro-N,2-dimethylheptan-3-imine.
| Compound Name | (4E)-4-ethylidene-5,5-difluoro-N,2-dimethylheptan-3-imine |
|---|---|
| PubChem CID | 171833118 |
| Molecular Formula | C11H19F2N |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | (4E)-4-ethylidene-5,5-difluoro-N,2-dimethylheptan-3-imine |
| SMILES | C/C=C(C(=N\C)\C(C)C)/C(F)(F)CC |
| InChI | InChI=1S/C11H19F2N/c1-6-9(11(12,13)7-2)10(14-5)8(3)4/h6,8H,7H2,1-5H3/b9-6+,14-10+ |
| InChIKey | CNCQFIYNLBEQLE-UYQSWCAZSA-N |
| XLogP | 3.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|