C13H16FN2- — CID 142522964
[2-fluoro-4-imino-3,5-di(propan-2-yl)cyclohexa-2,5-dien-1-ylidene]methylideneazanide (PubChem CID 142522964) has the molecular formula C13H16FN2- and a molecular weight of 219.28 g/mol. Its IUPAC name is [2-fluoro-4-imino-3,5-di(propan-2-yl)cyclohexa-2,5-dien-1-ylidene]methylideneazanide.
| Compound Name | [2-fluoro-4-imino-3,5-di(propan-2-yl)cyclohexa-2,5-dien-1-ylidene]methylideneazanide |
|---|---|
| PubChem CID | 142522964 |
| Molecular Formula | C13H16FN2- |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | [2-fluoro-4-imino-3,5-di(propan-2-yl)cyclohexa-2,5-dien-1-ylidene]methylideneazanide |
| SMILES | [H]/N=C1\C(C(C)C)=CC(=C=[N-])C(F)=C1C(C)C |
| InChI | InChI=1S/C13H16FN2/c1-7(2)10-5-9(6-15)12(14)11(8(3)4)13(10)16/h5,7-8,16H,1-4H3/q-1/b16-13+ |
| InChIKey | RWJAQXZILMOPSO-DTQAZKPQSA-N |
| XLogP | 3.65 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|