C17H20FN — CID 144913873
(6Z,8Z)-4-fluoro-2,6-dimethyl-10-propylidene-1,10a-dihydrobenzo[8]annulen-5-imine (PubChem CID 144913873) has the molecular formula C17H20FN and a molecular weight of 257.35 g/mol. Its IUPAC name is (6Z,8Z)-4-fluoro-2,6-dimethyl-10-propylidene-1,10a-dihydrobenzo[8]annulen-5-imine.
| Compound Name | (6Z,8Z)-4-fluoro-2,6-dimethyl-10-propylidene-1,10a-dihydrobenzo[8]annulen-5-imine |
|---|---|
| PubChem CID | 144913873 |
| Molecular Formula | C17H20FN |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | (6Z,8Z)-4-fluoro-2,6-dimethyl-10-propylidene-1,10a-dihydrobenzo[8]annulen-5-imine |
| SMILES | [H]/N=C1C2=C(F)C=C(C)CC2C(=CCC)/C=C\C=C/1C |
| InChI | InChI=1S/C17H20FN/c1-4-6-13-8-5-7-12(3)17(19)16-14(13)9-11(2)10-15(16)18/h5-8,10,14,19H,4,9H2,1-3H3/b8-5-,12-7-,13-6?,19-17+ |
| InChIKey | VCWGPUQPNWEOKS-ODLHORLZSA-N |
| XLogP | 5.05 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|