C19H25F2N — CID 142347279
butane;(6Z,8Z)-10-ethylidene-2,4-difluoro-6-methyl-1,10a-dihydrobenzo[8]annulen-5-imine (PubChem CID 142347279) has the molecular formula C19H25F2N and a molecular weight of 305.41 g/mol. Its IUPAC name is butane;(6Z,8Z)-10-ethylidene-2,4-difluoro-6-methyl-1,10a-dihydrobenzo[8]annulen-5-imine.
| Compound Name | butane;(6Z,8Z)-10-ethylidene-2,4-difluoro-6-methyl-1,10a-dihydrobenzo[8]annulen-5-imine |
|---|---|
| PubChem CID | 142347279 |
| Molecular Formula | C19H25F2N |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | butane;(6Z,8Z)-10-ethylidene-2,4-difluoro-6-methyl-1,10a-dihydrobenzo[8]annulen-5-imine |
| SMILES | CCCC.[H]/N=C1C2=C(F)C=C(F)CC2C(=CC)/C=C\C=C/1C |
| InChI | InChI=1S/C15H15F2N.C4H10/c1-3-10-6-4-5-9(2)15(18)14-12(10)7-11(16)8-13(14)17;1-3-4-2/h3-6,8,12,18H,7H2,1-2H3;3-4H2,1-2H3/b6-4-,9-5-,10-3?,18-15+; |
| InChIKey | IOVOEQPMBZPQAY-PFMNITPYSA-N |
| XLogP | 6.37 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|