C25H30FN — CID 144805589
3-[(Z)-3-cycloprop-2-en-1-ylidene-3-fluoro-2-methylprop-1-enyl]-4,4,5-trimethyl-8-pent-2-enyl-7,8-dihydronaphthalen-1-imine (PubChem CID 144805589) has the molecular formula C25H30FN and a molecular weight of 363.52 g/mol. Its IUPAC name is 3-[(Z)-3-cycloprop-2-en-1-ylidene-3-fluoro-2-methylprop-1-enyl]-4,4,5-trimethyl-8-pent-2-enyl-7,8-dihydronaphthalen-1-imine.
| Compound Name | 3-[(Z)-3-cycloprop-2-en-1-ylidene-3-fluoro-2-methylprop-1-enyl]-4,4,5-trimethyl-8-pent-2-enyl-7,8-dihydronaphthalen-1-imine |
|---|---|
| PubChem CID | 144805589 |
| Molecular Formula | C25H30FN |
| Molecular Weight | 363.52 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 3-[(Z)-3-cycloprop-2-en-1-ylidene-3-fluoro-2-methylprop-1-enyl]-4,4,5-trimethyl-8-pent-2-enyl-7,8-dihydronaphthalen-1-imine |
| SMILES | [H]/N=C1\C=C(/C=C(/C)C(F)=C2C=C2)C(C)(C)C2=C1C(CC=CCC)CC=C2C |
| InChI | InChI=1S/C25H30FN/c1-6-7-8-9-18-11-10-16(2)23-22(18)21(27)15-20(25(23,4)5)14-17(3)24(26)19-12-13-19/h7-8,10,12-15,18,27H,6,9,11H2,1-5H3/b8-7?,17-14-,27-21+ |
| InChIKey | BJBVFOXTCCXDAC-MEHSXJMASA-N |
| XLogP | 7.33 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.52 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|