C18H23F2N — CID 142417734
butane;(6Z,8Z)-10-ethylidene-2,4-difluoro-1,10a-dihydrobenzo[8]annulen-5-imine (PubChem CID 142417734) has the molecular formula C18H23F2N and a molecular weight of 291.39 g/mol. Its IUPAC name is butane;(6Z,8Z)-10-ethylidene-2,4-difluoro-1,10a-dihydrobenzo[8]annulen-5-imine.
| Compound Name | butane;(6Z,8Z)-10-ethylidene-2,4-difluoro-1,10a-dihydrobenzo[8]annulen-5-imine |
|---|---|
| PubChem CID | 142417734 |
| Molecular Formula | C18H23F2N |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | butane;(6Z,8Z)-10-ethylidene-2,4-difluoro-1,10a-dihydrobenzo[8]annulen-5-imine |
| SMILES | CCCC.[H]/N=C1\C=C/C=C\C(=CC)C2CC(F)=CC(F)=C12 |
| InChI | InChI=1S/C14H13F2N.C4H10/c1-2-9-5-3-4-6-13(17)14-11(9)7-10(15)8-12(14)16;1-3-4-2/h2-6,8,11,17H,7H2,1H3;3-4H2,1-2H3/b5-3-,6-4-,9-2?,17-13+; |
| InChIKey | RFCACXZKMMXBCL-GGXNSYPESA-N |
| XLogP | 5.98 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|