C10H14F3N — CID 174289820
(4E,6Z)-2-methyl-4-(trifluoromethyl)octa-4,6-dien-3-imine (PubChem CID 174289820) has the molecular formula C10H14F3N and a molecular weight of 205.22 g/mol. Its IUPAC name is (4E,6Z)-2-methyl-4-(trifluoromethyl)octa-4,6-dien-3-imine.
| Compound Name | (4E,6Z)-2-methyl-4-(trifluoromethyl)octa-4,6-dien-3-imine |
|---|---|
| PubChem CID | 174289820 |
| Molecular Formula | C10H14F3N |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (4E,6Z)-2-methyl-4-(trifluoromethyl)octa-4,6-dien-3-imine |
| SMILES | [H]/N=C(C(=C\C=C/C)/C(F)(F)F)\C(C)C |
| InChI | InChI=1S/C10H14F3N/c1-4-5-6-8(10(11,12)13)9(14)7(2)3/h4-7,14H,1-3H3/b5-4-,8-6+,14-9+ |
| InChIKey | PKPKHKBYHHRHBH-QWIHDJANSA-N |
| XLogP | 3.73 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|