C20H31N — CID 91041769
3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,7-trien-5-imine (PubChem CID 91041769) has the molecular formula C20H31N and a molecular weight of 285.47 g/mol. Its IUPAC name is 3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,7-trien-5-imine.
| Compound Name | 3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,7-trien-5-imine |
|---|---|
| PubChem CID | 91041769 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | 3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,7-trien-5-imine |
| SMILES | [H]/N=C(/C=C(C)C=CC1=C(C)CCCC1(C)C)CC(C)=CC |
| InChI | InChI=1S/C20H31N/c1-7-15(2)13-18(21)14-16(3)10-11-19-17(4)9-8-12-20(19,5)6/h7,10-11,14,21H,8-9,12-13H2,1-6H3/b11-10?,15-7?,16-14?,21-18+ |
| InChIKey | JJXMUVDNLUQHBO-HUEURDLXSA-N |
| XLogP | 6.39 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|