C9H15N — CID 12562470
3,5,5-trimethylcyclohex-2-en-1-imine (PubChem CID 12562470) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 3,5,5-trimethylcyclohex-2-en-1-imine.
| Compound Name | 3,5,5-trimethylcyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 12562470 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 3,5,5-trimethylcyclohex-2-en-1-imine |
| SMILES | [H]/N=C1\C=C(C)CC(C)(C)C1 |
| InChI | InChI=1S/C9H15N/c1-7-4-8(10)6-9(2,3)5-7/h4,10H,5-6H2,1-3H3/b10-8+ |
| InChIKey | FZBHBMHNTDJYLD-CSKARUKUSA-N |
| XLogP | 2.77 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|