C18H28N2 — CID 6174049
(Z)-3,5,5-trimethyl-N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]cyclohex-2-en-1-imine (PubChem CID 6174049) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is (Z)-3,5,5-trimethyl-N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]cyclohex-2-en-1-imine.
| Compound Name | (Z)-3,5,5-trimethyl-N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]cyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 6174049 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | (Z)-3,5,5-trimethyl-N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]cyclohex-2-en-1-imine |
| SMILES | CC1=C/C(=N\N=C2\C=C(C)CC(C)(C)C2)CC(C)(C)C1 |
| InChI | InChI=1S/C18H28N2/c1-13-7-15(11-17(3,4)9-13)19-20-16-8-14(2)10-18(5,6)12-16/h7-8H,9-12H2,1-6H3/b19-15-,20-16+ |
| InChIKey | XJEYYLXANADAGE-VBGLAJCLSA-N |
| XLogP | 5.32 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|