C16H24N2 — CID 56639224
N-[(3,5-dimethylcyclohex-2-en-1-ylidene)amino]-3,5-dimethylcyclohex-2-en-1-imine (PubChem CID 56639224) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-2-en-1-ylidene)amino]-3,5-dimethylcyclohex-2-en-1-imine.
| Compound Name | N-[(3,5-dimethylcyclohex-2-en-1-ylidene)amino]-3,5-dimethylcyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 56639224 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-2-en-1-ylidene)amino]-3,5-dimethylcyclohex-2-en-1-imine |
| SMILES | CC1=CC(=NN=C2C=C(C)CC(C)C2)CC(C)C1 |
| InChI | InChI=1S/C16H24N2/c1-11-5-12(2)8-15(7-11)17-18-16-9-13(3)6-14(4)10-16/h7,9,12,14H,5-6,8,10H2,1-4H3 |
| InChIKey | MBICXNZULRPBPL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|