C20H28N2 — CID 90895242
1-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]-N-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylideneamino]methanimine (PubChem CID 90895242) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 1-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]-N-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylideneamino]methanimine.
| Compound Name | 1-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]-N-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylideneamino]methanimine |
|---|---|
| PubChem CID | 90895242 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 1-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]-N-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylideneamino]methanimine |
| SMILES | C=C(C)[C@@H]1CC=C(C=NN=CC2=CC[C@@H](C(=C)C)CC2)CC1 |
| InChI | InChI=1S/C20H28N2/c1-15(2)19-9-5-17(6-10-19)13-21-22-14-18-7-11-20(12-8-18)16(3)4/h5,7,13-14,19-20H,1,3,6,8-12H2,2,4H3/t19-,20-/m1/s1 |
| InChIKey | SRZSCWRPNPXZOA-WOJBJXKFSA-N |
| XLogP | 5.65 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|