C23H38N2 — CID 141295656
3,5,5-trimethyl-N-[5-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pentyl]cyclohex-2-en-1-imine (PubChem CID 141295656) has the molecular formula C23H38N2 and a molecular weight of 342.57 g/mol. Its IUPAC name is 3,5,5-trimethyl-N-[5-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pentyl]cyclohex-2-en-1-imine.
| Compound Name | 3,5,5-trimethyl-N-[5-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pentyl]cyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 141295656 |
| Molecular Formula | C23H38N2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | 3,5,5-trimethyl-N-[5-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pentyl]cyclohex-2-en-1-imine |
| SMILES | CC1=C/C(=N\CCCCC/N=C2\C=C(C)CC(C)(C)C2)CC(C)(C)C1 |
| InChI | InChI=1S/C23H38N2/c1-18-12-20(16-22(3,4)14-18)24-10-8-7-9-11-25-21-13-19(2)15-23(5,6)17-21/h12-13H,7-11,14-17H2,1-6H3/b24-20+,25-21+ |
| InChIKey | CKVHCKRSFRUHFD-CTWPWMDCSA-N |
| XLogP | 6.57 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|