C11H17N — CID 154719804
1-methyl-2-azaspiro[5.5]undeca-1,9-diene (PubChem CID 154719804) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 1-methyl-2-azaspiro[5.5]undeca-1,9-diene.
| Compound Name | 1-methyl-2-azaspiro[5.5]undeca-1,9-diene |
|---|---|
| PubChem CID | 154719804 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 1-methyl-2-azaspiro[5.5]undeca-1,9-diene |
| SMILES | CC1=NCCCC12CC=CCC2 |
| InChI | InChI=1S/C11H17N/c1-10-11(8-5-9-12-10)6-3-2-4-7-11/h2-3H,4-9H2,1H3 |
| InChIKey | XBLDZRRUOKHRJD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|