C11H17N — CID 13272643
6,6-dimethyl-3,4,4a,5-tetrahydro-2H-quinoline (PubChem CID 13272643) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 6,6-dimethyl-3,4,4a,5-tetrahydro-2H-quinoline.
| Compound Name | 6,6-dimethyl-3,4,4a,5-tetrahydro-2H-quinoline |
|---|---|
| PubChem CID | 13272643 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 6,6-dimethyl-3,4,4a,5-tetrahydro-2H-quinoline |
| SMILES | CC1(C)C=CC2=NCCCC2C1 |
| InChI | InChI=1S/C11H17N/c1-11(2)6-5-10-9(8-11)4-3-7-12-10/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | ZWLUZXIGSLCMNH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |