C14H17N — CID 10965517
(3aS,9aR,9bR)-6,9a-dimethyl-3,3a,4,9b-tetrahydrocyclopenta[c]quinoline (PubChem CID 10965517) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is (3aS,9aR,9bR)-6,9a-dimethyl-3,3a,4,9b-tetrahydrocyclopenta[c]quinoline.
| Compound Name | (3aS,9aR,9bR)-6,9a-dimethyl-3,3a,4,9b-tetrahydrocyclopenta[c]quinoline |
|---|---|
| PubChem CID | 10965517 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (3aS,9aR,9bR)-6,9a-dimethyl-3,3a,4,9b-tetrahydrocyclopenta[c]quinoline |
| SMILES | CC1=CC=C[C@@]2(C)C1=NC[C@H]1CC=C[C@H]12 |
| InChI | InChI=1S/C14H17N/c1-10-5-4-8-14(2)12-7-3-6-11(12)9-15-13(10)14/h3-5,7-8,11-12H,6,9H2,1-2H3/t11-,12-,14-/m1/s1 |
| InChIKey | RBDMKKPTZOHTGU-YRGRVCCFSA-N |
| XLogP | 3.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|