C11H11N — CID 57214759
2,2a,8,9-tetrahydrobenzo[cd]indole (PubChem CID 57214759) has the molecular formula C11H11N and a molecular weight of 157.22 g/mol. Its IUPAC name is 2,2a,8,9-tetrahydrobenzo[cd]indole.
| Compound Name | 2,2a,8,9-tetrahydrobenzo[cd]indole |
|---|---|
| PubChem CID | 57214759 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2,2a,8,9-tetrahydrobenzo[cd]indole |
| SMILES | C1=CC2CN=C3CC=CC(=C1)C32 |
| InChI | InChI=1S/C11H11N/c1-3-8-4-2-6-10-11(8)9(5-1)7-12-10/h1-5,9,11H,6-7H2 |
| InChIKey | XRWXZLDHEYBYGN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |