C13H17N — CID 20634344
3-ethenyl-4,5,6-trimethyl-3a,7a-dihydro-1H-isoindole (PubChem CID 20634344) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-ethenyl-4,5,6-trimethyl-3a,7a-dihydro-1H-isoindole.
| Compound Name | 3-ethenyl-4,5,6-trimethyl-3a,7a-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 20634344 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 3-ethenyl-4,5,6-trimethyl-3a,7a-dihydro-1H-isoindole |
| SMILES | C=CC1=NCC2C=C(C)C(C)=C(C)C12 |
| InChI | InChI=1S/C13H17N/c1-5-12-13-10(4)9(3)8(2)6-11(13)7-14-12/h5-6,11,13H,1,7H2,2-4H3 |
| InChIKey | SIQFREPNLYGDMH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |