C19H25N — CID 15920836
5-[(2E)-1-tricyclo[9.2.2.02,10]pentadeca-2,12,14-trienyl]-3,4-dihydro-2H-pyrrole (PubChem CID 15920836) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 5-[(2E)-1-tricyclo[9.2.2.02,10]pentadeca-2,12,14-trienyl]-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-[(2E)-1-tricyclo[9.2.2.02,10]pentadeca-2,12,14-trienyl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 15920836 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 5-[(2E)-1-tricyclo[9.2.2.02,10]pentadeca-2,12,14-trienyl]-3,4-dihydro-2H-pyrrole |
| SMILES | C1=CC2(C3=NCCC3)C=CC1C1CCCCCC/C=C\12 |
| InChI | InChI=1S/C19H25N/c1-2-4-7-16-15-10-12-19(13-11-15,17(16)8-5-3-1)18-9-6-14-20-18/h8,10-13,15-16H,1-7,9,14H2/b17-8+ |
| InChIKey | UDZYNSUWZAOKNN-CAOOACKPSA-N |
| XLogP | 4.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|