C18H31N — CID 123142784
(2Z)-N-(3-cyclopentylbutyl)-5-methylocta-2,5-dien-4-imine (PubChem CID 123142784) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is (2Z)-N-(3-cyclopentylbutyl)-5-methylocta-2,5-dien-4-imine.
| Compound Name | (2Z)-N-(3-cyclopentylbutyl)-5-methylocta-2,5-dien-4-imine |
|---|---|
| PubChem CID | 123142784 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | (2Z)-N-(3-cyclopentylbutyl)-5-methylocta-2,5-dien-4-imine |
| SMILES | C/C=C\C(=N\CCC(C)C1CCCC1)C(C)=CCC |
| InChI | InChI=1S/C18H31N/c1-5-9-16(4)18(10-6-2)19-14-13-15(3)17-11-7-8-12-17/h6,9-10,15,17H,5,7-8,11-14H2,1-4H3/b10-6-,16-9?,19-18- |
| InChIKey | PYDHYEWNDBUPMB-SJTVFMRLSA-N |
| XLogP | 5.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|