C13H23N — CID 102519273
5-methyl-2-(6-methylhept-5-en-2-yl)-3,4-dihydro-2H-pyrrole (PubChem CID 102519273) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 5-methyl-2-(6-methylhept-5-en-2-yl)-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-methyl-2-(6-methylhept-5-en-2-yl)-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 102519273 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 5-methyl-2-(6-methylhept-5-en-2-yl)-3,4-dihydro-2H-pyrrole |
| SMILES | CC(C)=CCCC(C)C1CCC(C)=N1 |
| InChI | InChI=1S/C13H23N/c1-10(2)6-5-7-11(3)13-9-8-12(4)14-13/h6,11,13H,5,7-9H2,1-4H3 |
| InChIKey | GREWKWOKHMBDEW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|