C12H17N — CID 102274163
(3aR,4Z,9Z,10aS)-2-methyl-3,3a,6,7,8,10a-hexahydrocyclonona[b]pyrrole (PubChem CID 102274163) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is (3aR,4Z,9Z,10aS)-2-methyl-3,3a,6,7,8,10a-hexahydrocyclonona[b]pyrrole.
| Compound Name | (3aR,4Z,9Z,10aS)-2-methyl-3,3a,6,7,8,10a-hexahydrocyclonona[b]pyrrole |
|---|---|
| PubChem CID | 102274163 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (3aR,4Z,9Z,10aS)-2-methyl-3,3a,6,7,8,10a-hexahydrocyclonona[b]pyrrole |
| SMILES | CC1=N[C@H]2/C=C\CCC/C=C\[C@H]2C1 |
| InChI | InChI=1S/C12H17N/c1-10-9-11-7-5-3-2-4-6-8-12(11)13-10/h5-8,11-12H,2-4,9H2,1H3/b7-5-,8-6-/t11-,12-/m0/s1 |
| InChIKey | LHJOZPYYVZLRAD-NHEBJRQNSA-N |
| XLogP | 3.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|