C20H37N — CID 5369018
5-methyl-4-[(Z)-pentadec-7-enyl]-3,4-dihydro-2H-pyrrole (PubChem CID 5369018) has the molecular formula C20H37N and a molecular weight of 291.52 g/mol. Its IUPAC name is 5-methyl-4-[(Z)-pentadec-7-enyl]-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-methyl-4-[(Z)-pentadec-7-enyl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 5369018 |
| Molecular Formula | C20H37N |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 291.29 |
| IUPAC Name | 5-methyl-4-[(Z)-pentadec-7-enyl]-3,4-dihydro-2H-pyrrole |
| SMILES | CCCCCCC/C=C\CCCCCCC1CCN=C1C |
| InChI | InChI=1S/C20H37N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-17-18-21-19(20)2/h9-10,20H,3-8,11-18H2,1-2H3/b10-9- |
| InChIKey | FWSSLXUYBRZUKY-KTKRTIGZSA-N |
| XLogP | 6.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|