C24H43N — CID 72781473
5-methyl-4-nonadec-12-enylidene-2,3-dihydropyrrole (PubChem CID 72781473) has the molecular formula C24H43N and a molecular weight of 345.62 g/mol. Its IUPAC name is 5-methyl-4-nonadec-12-enylidene-2,3-dihydropyrrole.
| Compound Name | 5-methyl-4-nonadec-12-enylidene-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 72781473 |
| Molecular Formula | C24H43N |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 345.34 |
| IUPAC Name | 5-methyl-4-nonadec-12-enylidene-2,3-dihydropyrrole |
| SMILES | CCCCCCC=CCCCCCCCCCCC=C1CCN=C1C |
| InChI | InChI=1S/C24H43N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-21-22-25-23(24)2/h8-9,20H,3-7,10-19,21-22H2,1-2H3 |
| InChIKey | CTEOHBYQNVFMJZ-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|