C17H32FN — CID 170616648
(E)-N-[(4R)-2,7-dimethyloctan-4-yl]-3-fluoro-3-methylhex-4-en-2-imine (PubChem CID 170616648) has the molecular formula C17H32FN and a molecular weight of 269.45 g/mol. Its IUPAC name is (E)-N-[(4R)-2,7-dimethyloctan-4-yl]-3-fluoro-3-methylhex-4-en-2-imine.
| Compound Name | (E)-N-[(4R)-2,7-dimethyloctan-4-yl]-3-fluoro-3-methylhex-4-en-2-imine |
|---|---|
| PubChem CID | 170616648 |
| Molecular Formula | C17H32FN |
| Molecular Weight | 269.45 g/mol |
| Exact Mass | 269.25 |
| IUPAC Name | (E)-N-[(4R)-2,7-dimethyloctan-4-yl]-3-fluoro-3-methylhex-4-en-2-imine |
| SMILES | C/C=C/C(C)(F)/C(C)=N/[C@H](CCC(C)C)CC(C)C |
| InChI | InChI=1S/C17H32FN/c1-8-11-17(7,18)15(6)19-16(12-14(4)5)10-9-13(2)3/h8,11,13-14,16H,9-10,12H2,1-7H3/b11-8+,19-15+/t16-,17?/m1/s1 |
| InChIKey | LOAUFWZYEAJGMD-KTHXFOCHSA-N |
| XLogP | 5.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.45 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|