C18H33N — CID 162967188
(4S)-5-methyl-4-[(Z)-tridec-5-enyl]-3,4-dihydro-2H-pyrrole (PubChem CID 162967188) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is (4S)-5-methyl-4-[(Z)-tridec-5-enyl]-3,4-dihydro-2H-pyrrole.
| Compound Name | (4S)-5-methyl-4-[(Z)-tridec-5-enyl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 162967188 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | (4S)-5-methyl-4-[(Z)-tridec-5-enyl]-3,4-dihydro-2H-pyrrole |
| SMILES | CCCCCCC/C=C\CCCC[C@H]1CCN=C1C |
| InChI | InChI=1S/C18H33N/c1-3-4-5-6-7-8-9-10-11-12-13-14-18-15-16-19-17(18)2/h9-10,18H,3-8,11-16H2,1-2H3/b10-9-/t18-/m0/s1 |
| InChIKey | LBJVZZRIPHSKNP-LPADLIQXSA-N |
| XLogP | 5.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|