C22H41N — CID 91530706
3-hexadecyl-5-methyl-4-methylidene-2,3-dihydropyrrole (PubChem CID 91530706) has the molecular formula C22H41N and a molecular weight of 319.58 g/mol. Its IUPAC name is 3-hexadecyl-5-methyl-4-methylidene-2,3-dihydropyrrole.
| Compound Name | 3-hexadecyl-5-methyl-4-methylidene-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 91530706 |
| Molecular Formula | C22H41N |
| Molecular Weight | 319.58 g/mol |
| Exact Mass | 319.32 |
| IUPAC Name | 3-hexadecyl-5-methyl-4-methylidene-2,3-dihydropyrrole |
| SMILES | C=C1C(C)=NCC1CCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C22H41N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-19-23-21(3)20(22)2/h22H,2,4-19H2,1,3H3 |
| InChIKey | SMVKVZUYYHJKEF-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.58 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|