C11H19N — CID 134864048
5-hept-1-en-4-yl-3,4-dihydro-2H-pyrrole (PubChem CID 134864048) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 5-hept-1-en-4-yl-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-hept-1-en-4-yl-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 134864048 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 5-hept-1-en-4-yl-3,4-dihydro-2H-pyrrole |
| SMILES | C=CCC(CCC)C1=NCCC1 |
| InChI | InChI=1S/C11H19N/c1-3-6-10(7-4-2)11-8-5-9-12-11/h3,10H,1,4-9H2,2H3 |
| InChIKey | CHEZODFSNLNUIF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|