C15H28FN — CID 143491208
(Z)-6-ethyl-7-(fluoromethyl)-N-methylundec-8-en-5-imine (PubChem CID 143491208) has the molecular formula C15H28FN and a molecular weight of 241.39 g/mol. Its IUPAC name is (Z)-6-ethyl-7-(fluoromethyl)-N-methylundec-8-en-5-imine.
| Compound Name | (Z)-6-ethyl-7-(fluoromethyl)-N-methylundec-8-en-5-imine |
|---|---|
| PubChem CID | 143491208 |
| Molecular Formula | C15H28FN |
| Molecular Weight | 241.39 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | (Z)-6-ethyl-7-(fluoromethyl)-N-methylundec-8-en-5-imine |
| SMILES | CC/C=C\C(CF)C(CC)/C(CCCC)=N/C |
| InChI | InChI=1S/C15H28FN/c1-5-8-10-13(12-16)14(7-3)15(17-4)11-9-6-2/h8,10,13-14H,5-7,9,11-12H2,1-4H3/b10-8-,17-15+ |
| InChIKey | RUIHHDFQQLLELG-RDCZQFDASA-N |
| XLogP | 4.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|