C12H20F3N — CID 166470434
(Z)-N-ethyl-7-methyl-6-(trifluoromethyl)oct-2-en-4-imine (PubChem CID 166470434) has the molecular formula C12H20F3N and a molecular weight of 235.29 g/mol. Its IUPAC name is (Z)-N-ethyl-7-methyl-6-(trifluoromethyl)oct-2-en-4-imine.
| Compound Name | (Z)-N-ethyl-7-methyl-6-(trifluoromethyl)oct-2-en-4-imine |
|---|---|
| PubChem CID | 166470434 |
| Molecular Formula | C12H20F3N |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | (Z)-N-ethyl-7-methyl-6-(trifluoromethyl)oct-2-en-4-imine |
| SMILES | C/C=C\C(CC(C(C)C)C(F)(F)F)=N/CC |
| InChI | InChI=1S/C12H20F3N/c1-5-7-10(16-6-2)8-11(9(3)4)12(13,14)15/h5,7,9,11H,6,8H2,1-4H3/b7-5-,16-10+ |
| InChIKey | OSSKMHDKWSNGDI-NUNJDRMESA-N |
| XLogP | 4.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|