C14H23F2N — CID 144526431
4-[(1S)-1,4-dimethylcyclopent-2-en-1-yl]-2,2-difluoro-N-methylhexan-3-imine (PubChem CID 144526431) has the molecular formula C14H23F2N and a molecular weight of 243.34 g/mol. Its IUPAC name is 4-[(1S)-1,4-dimethylcyclopent-2-en-1-yl]-2,2-difluoro-N-methylhexan-3-imine.
| Compound Name | 4-[(1S)-1,4-dimethylcyclopent-2-en-1-yl]-2,2-difluoro-N-methylhexan-3-imine |
|---|---|
| PubChem CID | 144526431 |
| Molecular Formula | C14H23F2N |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 4-[(1S)-1,4-dimethylcyclopent-2-en-1-yl]-2,2-difluoro-N-methylhexan-3-imine |
| SMILES | CCC(/C(=N/C)C(C)(F)F)[C@]1(C)C=CC(C)C1 |
| InChI | InChI=1S/C14H23F2N/c1-6-11(12(17-5)14(4,15)16)13(3)8-7-10(2)9-13/h7-8,10-11H,6,9H2,1-5H3/b17-12-/t10?,11?,13-/m1/s1 |
| InChIKey | JTVOCLJRXFMBLU-ZRSZOVOKSA-N |
| XLogP | 4.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|