C11H16F3N — CID 59159512
2-[3,3-dimethyl-2-(trifluoromethyl)butyl]-3H-pyrrole (PubChem CID 59159512) has the molecular formula C11H16F3N and a molecular weight of 219.25 g/mol. Its IUPAC name is 2-[3,3-dimethyl-2-(trifluoromethyl)butyl]-3H-pyrrole.
| Compound Name | 2-[3,3-dimethyl-2-(trifluoromethyl)butyl]-3H-pyrrole |
|---|---|
| PubChem CID | 59159512 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 2-[3,3-dimethyl-2-(trifluoromethyl)butyl]-3H-pyrrole |
| SMILES | CC(C)(C)C(CC1=NC=CC1)C(F)(F)F |
| InChI | InChI=1S/C11H16F3N/c1-10(2,3)9(11(12,13)14)7-8-5-4-6-15-8/h4,6,9H,5,7H2,1-3H3 |
| InChIKey | GJFNWIZPCMBQMQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |