C26H50F2NP — CID 144526429
4-[(1S)-1,4-dimethylcyclopent-2-en-1-yl]-2,2-difluoro-N-methylhexan-3-imine;ethane;[(2S)-2-ethylcyclohexyl]-dimethylphosphane (PubChem CID 144526429) has the molecular formula C26H50F2NP and a molecular weight of 445.66 g/mol. Its IUPAC name is 4-[(1S)-1,4-dimethylcyclopent-2-en-1-yl]-2,2-difluoro-N-methylhexan-3-imine;ethane;[(2S)-2-ethylcyclohexyl]-dimethylphosphane.
| Compound Name | 4-[(1S)-1,4-dimethylcyclopent-2-en-1-yl]-2,2-difluoro-N-methylhexan-3-imine;ethane;[(2S)-2-ethylcyclohexyl]-dimethylphosphane |
|---|---|
| PubChem CID | 144526429 |
| Molecular Formula | C26H50F2NP |
| Molecular Weight | 445.66 g/mol |
| Exact Mass | 445.36 |
| IUPAC Name | 4-[(1S)-1,4-dimethylcyclopent-2-en-1-yl]-2,2-difluoro-N-methylhexan-3-imine;ethane;[(2S)-2-ethylcyclohexyl]-dimethylphosphane |
| SMILES | CC.CCC(/C(=N/C)C(C)(F)F)[C@]1(C)C=CC(C)C1.CC[C@H]1CCCCC1P(C)C |
| InChI | InChI=1S/C14H23F2N.C10H21P.C2H6/c1-6-11(12(17-5)14(4,15)16)13(3)8-7-10(2)9-13;1-4-9-7-5-6-8-10(9)11(2)3;1-2/h7-8,10-11H,6,9H2,1-5H3;9-10H,4-8H2,1-3H3;1-2H3/b17-12-;;/t10?,11?,13-;9-,10?;/m10./s1 |
| InChIKey | AAWUQKCTVLNYEC-JJQHIGAJSA-N |
| XLogP | 9.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.66 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|