C16H28FN — CID 143491167
(8E,10Z)-6-ethyl-9-fluoro-N,7-dimethyldodeca-8,10-dien-5-imine (PubChem CID 143491167) has the molecular formula C16H28FN and a molecular weight of 253.41 g/mol. Its IUPAC name is (8E,10Z)-6-ethyl-9-fluoro-N,7-dimethyldodeca-8,10-dien-5-imine.
| Compound Name | (8E,10Z)-6-ethyl-9-fluoro-N,7-dimethyldodeca-8,10-dien-5-imine |
|---|---|
| PubChem CID | 143491167 |
| Molecular Formula | C16H28FN |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | (8E,10Z)-6-ethyl-9-fluoro-N,7-dimethyldodeca-8,10-dien-5-imine |
| SMILES | C/C=C\C(F)=C/C(C)C(CC)/C(CCCC)=N/C |
| InChI | InChI=1S/C16H28FN/c1-6-9-11-16(18-5)15(8-3)13(4)12-14(17)10-7-2/h7,10,12-13,15H,6,8-9,11H2,1-5H3/b10-7-,14-12+,18-16+ |
| InChIKey | ATRORXOEKGXEMM-GHTCGNQISA-N |
| XLogP | 5.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|