C14H20FN — CID 167026133
(2S)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-5-propan-2-yl-3,4-dihydro-2H-pyrrole (PubChem CID 167026133) has the molecular formula C14H20FN and a molecular weight of 221.32 g/mol. Its IUPAC name is (2S)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-5-propan-2-yl-3,4-dihydro-2H-pyrrole.
| Compound Name | (2S)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-5-propan-2-yl-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 167026133 |
| Molecular Formula | C14H20FN |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | (2S)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-5-propan-2-yl-3,4-dihydro-2H-pyrrole |
| SMILES | C=C(/C=C\C(F)=C/C)[C@@H]1CCC(C(C)C)=N1 |
| InChI | InChI=1S/C14H20FN/c1-5-12(15)7-6-11(4)14-9-8-13(16-14)10(2)3/h5-7,10,14H,4,8-9H2,1-3H3/b7-6-,12-5+/t14-/m0/s1 |
| InChIKey | KOXPZUQVKZAXMY-RBTWUDAMSA-N |
| XLogP | 4.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|