C13H18FN — CID 123688718
9-fluoro-2,7-dimethyl-3,4,4a,5,6,10a-hexahydrocycloocta[b]pyridine (PubChem CID 123688718) has the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. Its IUPAC name is 9-fluoro-2,7-dimethyl-3,4,4a,5,6,10a-hexahydrocycloocta[b]pyridine.
| Compound Name | 9-fluoro-2,7-dimethyl-3,4,4a,5,6,10a-hexahydrocycloocta[b]pyridine |
|---|---|
| PubChem CID | 123688718 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 9-fluoro-2,7-dimethyl-3,4,4a,5,6,10a-hexahydrocycloocta[b]pyridine |
| SMILES | CC1=CC(F)=CC2N=C(C)CCC2CC1 |
| InChI | InChI=1S/C13H18FN/c1-9-3-5-11-6-4-10(2)15-13(11)8-12(14)7-9/h7-8,11,13H,3-6H2,1-2H3 |
| InChIKey | QPXKVIJNSIIQFO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |