C14H21N — CID 123203425
2-buta-1,3-dienyl-3-butan-2-yl-6-methyl-2,5-dihydropyridine (PubChem CID 123203425) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 2-buta-1,3-dienyl-3-butan-2-yl-6-methyl-2,5-dihydropyridine.
| Compound Name | 2-buta-1,3-dienyl-3-butan-2-yl-6-methyl-2,5-dihydropyridine |
|---|---|
| PubChem CID | 123203425 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 2-buta-1,3-dienyl-3-butan-2-yl-6-methyl-2,5-dihydropyridine |
| SMILES | C=CC=CC1N=C(C)CC=C1C(C)CC |
| InChI | InChI=1S/C14H21N/c1-5-7-8-14-13(11(3)6-2)10-9-12(4)15-14/h5,7-8,10-11,14H,1,6,9H2,2-4H3 |
| InChIKey | IHABFWVFFLRPJK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|