C15H23N — CID 123428408
(4Z)-2-buta-1,3-dienyl-3,5-diethyl-4-propylidene-2,3-dihydropyrrole (PubChem CID 123428408) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is (4Z)-2-buta-1,3-dienyl-3,5-diethyl-4-propylidene-2,3-dihydropyrrole.
| Compound Name | (4Z)-2-buta-1,3-dienyl-3,5-diethyl-4-propylidene-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 123428408 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (4Z)-2-buta-1,3-dienyl-3,5-diethyl-4-propylidene-2,3-dihydropyrrole |
| SMILES | C=CC=CC1N=C(CC)/C(=C\CC)C1CC |
| InChI | InChI=1S/C15H23N/c1-5-9-11-15-12(7-3)13(10-6-2)14(8-4)16-15/h5,9-12,15H,1,6-8H2,2-4H3/b11-9?,13-10- |
| InChIKey | GIOVQHMAEQVLAY-MRDQSCOPSA-N |
| XLogP | 4.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|