C31H51N — CID 123401859
N-[[4-(3,6-dimethylcyclohexa-2,4-dien-1-yl)cyclohexa-2,4-dien-1-yl]methyl]-5,6,6-triethyl-3,7-dimethyloctan-2-imine (PubChem CID 123401859) has the molecular formula C31H51N and a molecular weight of 437.76 g/mol. Its IUPAC name is N-[[4-(3,6-dimethylcyclohexa-2,4-dien-1-yl)cyclohexa-2,4-dien-1-yl]methyl]-5,6,6-triethyl-3,7-dimethyloctan-2-imine.
| Compound Name | N-[[4-(3,6-dimethylcyclohexa-2,4-dien-1-yl)cyclohexa-2,4-dien-1-yl]methyl]-5,6,6-triethyl-3,7-dimethyloctan-2-imine |
|---|---|
| PubChem CID | 123401859 |
| Molecular Formula | C31H51N |
| Molecular Weight | 437.76 g/mol |
| Exact Mass | 437.40 |
| IUPAC Name | N-[[4-(3,6-dimethylcyclohexa-2,4-dien-1-yl)cyclohexa-2,4-dien-1-yl]methyl]-5,6,6-triethyl-3,7-dimethyloctan-2-imine |
| SMILES | CCC(CC(C)/C(C)=N/CC1C=CC(C2C=C(C)C=CC2C)=CC1)C(CC)(CC)C(C)C |
| InChI | InChI=1S/C31H51N/c1-10-29(31(11-2,12-3)22(4)5)20-25(8)26(9)32-21-27-15-17-28(18-16-27)30-19-23(6)13-14-24(30)7/h13-15,17-19,22,24-25,27,29-30H,10-12,16,20-21H2,1-9H3/b32-26+ |
| InChIKey | HNSLKCHWEVBAAO-HMZBKAONSA-N |
| XLogP | 9.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.76 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|