C22H35N — CID 22816623
(5E,9E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene (PubChem CID 22816623) has the molecular formula C22H35N and a molecular weight of 313.53 g/mol. Its IUPAC name is (5E,9E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene.
| Compound Name | (5E,9E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene |
|---|---|
| PubChem CID | 22816623 |
| Molecular Formula | C22H35N |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | (5E,9E)-2-spiro[5.5]undecan-4-yl-1-azacyclododeca-1,5,9-triene |
| SMILES | C1=C/CC/N=C(\C2CCCC3(CCCCC3)C2)CC/C=C/CC/1 |
| InChI | InChI=1S/C22H35N/c1-2-4-6-11-18-23-21(14-8-5-3-1)20-13-12-17-22(19-20)15-9-7-10-16-22/h3-6,20H,1-2,7-19H2/b5-3+,6-4+,23-21- |
| InChIKey | KWLJGBJIKWNFBV-SQGATDRVSA-N |
| XLogP | 6.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|