C15H25N — CID 144702819
2,6,6-trimethyl-N-[(E)-pent-3-enyl]bicyclo[3.1.1]heptan-3-imine (PubChem CID 144702819) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 2,6,6-trimethyl-N-[(E)-pent-3-enyl]bicyclo[3.1.1]heptan-3-imine.
| Compound Name | 2,6,6-trimethyl-N-[(E)-pent-3-enyl]bicyclo[3.1.1]heptan-3-imine |
|---|---|
| PubChem CID | 144702819 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 2,6,6-trimethyl-N-[(E)-pent-3-enyl]bicyclo[3.1.1]heptan-3-imine |
| SMILES | C/C=C/CC/N=C1\CC2CC(C1C)C2(C)C |
| InChI | InChI=1S/C15H25N/c1-5-6-7-8-16-14-10-12-9-13(11(14)2)15(12,3)4/h5-6,11-13H,7-10H2,1-4H3/b6-5+,16-14+ |
| InChIKey | FTWLDNWVOSLNMO-NIWSBHGSSA-N |
| XLogP | 4.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|